About (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol
(E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol (PubChem CID 144748718) has the molecular formula C21H22Cl2N2O
and a molecular weight of 389.33 g/mol. Its IUPAC name is (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol.
Molecular Properties
| Compound Name | (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol |
| PubChem CID | 144748718 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol |
| SMILES | [H]/N=C(CCN1c2ccc(Cl)cc2C(C)(C)c2cc(Cl)ccc21)\C(O)=C/C |
| InChI | InChI=1S/C21H22Cl2N2O/c1-4-20(26)17(24)9-10-25-18-7-5-13(22)11-15(18)21(2,3)16-12-14(23)6-8-19(16)25/h4-8,11-12,24,26H,9-10H2,1-3H3/b20-4+,24-17- |
| InChIKey | QCCWBMMBMWCKOM-ADFSAKMESA-N |
| XLogP | 6.64 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol?
The IUPAC name of (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol (CID 144748718) is (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol.
What is the SMILES notation for (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol?
The canonical SMILES for (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol is [H]/N=C(CCN1c2ccc(Cl)cc2C(C)(C)c2cc(Cl)ccc21)\C(O)=C/C.
What is the InChIKey of (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol?
The InChIKey is QCCWBMMBMWCKOM-ADFSAKMESA-N. The full InChI is InChI=1S/C21H22Cl2N2O/c1-4-20(26)17(24)9-10-25-18-7-5-13(22)11-15(18)21(2,3)16-12-14(23)6-8-19(16)25/h4-8,11-12,24,26H,9-10H2,1-3H3/b20-4+,24-17-.
What are the key properties of (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol?
(E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol has a molecular weight of 389.33 g/mol, XLogP of 6.64, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(2,7-dichloro-9,9-dimethylacridin-10-yl)-4-iminohex-2-en-3-ol is sourced from PubChem (CID 144748718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).