C25H40N2O — CID 144749127
3-[(1S,4aR)-1-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]-4-ethylbenzamide;(1R)-1-cyclopropylethanamine (PubChem CID 144749127) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is 3-[(1S,4aR)-1-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]-4-ethylbenzamide;(1R)-1-cyclopropylethanamine.
| Compound Name | 3-[(1S,4aR)-1-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]-4-ethylbenzamide;(1R)-1-cyclopropylethanamine |
|---|---|
| PubChem CID | 144749127 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | 3-[(1S,4aR)-1-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-yl]-4-ethylbenzamide;(1R)-1-cyclopropylethanamine |
| SMILES | CCc1ccc(C(N)=O)cc1[C@@]12CCCCC1[C@@H](C)CCC2.C[C@@H](N)C1CC1 |
| InChI | InChI=1S/C20H29NO.C5H11N/c1-3-15-9-10-16(19(21)22)13-18(15)20-11-5-4-8-17(20)14(2)7-6-12-20;1-4(6)5-2-3-5/h9-10,13-14,17H,3-8,11-12H2,1-2H3,(H2,21,22);4-5H,2-3,6H2,1H3/t14-,17?,20+;4-/m01/s1 |
| InChIKey | QATYDAZIXSDTCH-PAUPCARNSA-N |
| XLogP | 5.34 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |