About 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane
6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane (PubChem CID 144749520) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane |
| PubChem CID | 144749520 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane |
| SMILES | CC.NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H14N2O3.C2H6/c11-8(13)4-2-1-3-7-12-9(14)5-6-10(12)15;1-2/h5-6H,1-4,7H2,(H2,11,13);1-2H3 |
| InChIKey | GQLPVBCLXNUKCO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane (CID 144749520) is 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane is CC.NC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane?
The InChIKey is GQLPVBCLXNUKCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3.C2H6/c11-8(13)4-2-1-3-7-12-9(14)5-6-10(12)15;1-2/h5-6H,1-4,7H2,(H2,11,13);1-2H3.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane?
6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane has a molecular weight of 240.30 g/mol, XLogP of 0.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)hexanamide;ethane is sourced from PubChem (CID 144749520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).