C29H42ClN3O6 — CID 144749534
(2E,4Z,6E)-N-[1-[[(1Z,6E)-4-aminooxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylocta-2,4,6-trienamide (PubChem CID 144749534) has the molecular formula C29H42ClN3O6 and a molecular weight of 564.12 g/mol. Its IUPAC name is (2E,4Z,6E)-N-[1-[[(1Z,6E)-4-aminooxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylocta-2,4,6-trienamide.
| Compound Name | (2E,4Z,6E)-N-[1-[[(1Z,6E)-4-aminooxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 144749534 |
| Molecular Formula | C29H42ClN3O6 |
| Molecular Weight | 564.12 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (2E,4Z,6E)-N-[1-[[(1Z,6E)-4-aminooxy-7-chloroocta-1,6-dienyl]amino]-3,3-dimethyl-1-oxobutan-2-yl]-8-(5-methoxy-6-oxo-2,3-dihydropyran-2-yl)-6-methylocta-2,4,6-trienamide |
| SMILES | COC1=CCC(C/C=C(C)/C=C\C=C\C(=O)NC(C(=O)N/C=C\CC(C/C=C(\C)Cl)ON)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C29H42ClN3O6/c1-20(13-15-22-17-18-24(37-6)28(36)38-22)10-7-8-12-25(34)33-26(29(3,4)5)27(35)32-19-9-11-23(39-31)16-14-21(2)30/h7-10,12-14,18-19,22-23,26H,11,15-17,31H2,1-6H3,(H,32,35)(H,33,34)/b10-7-,12-8+,19-9-,20-13+,21-14+ |
| InChIKey | YTCAFZDLPFXWCM-REKZJAHTSA-N |
| XLogP | 4.62 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.12 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|