About ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine
ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine (PubChem CID 144749665) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine |
| PubChem CID | 144749665 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine |
| SMILES | CC.Cc1nnc(C(C)C)c2cnncc12 |
| InChI | InChI=1S/C10H12N4.C2H6/c1-6(2)10-9-5-12-11-4-8(9)7(3)13-14-10;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | NURMZZXECZPTCR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine?
The IUPAC name of ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine (CID 144749665) is ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine.
What is the SMILES notation for ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine?
The canonical SMILES for ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine is CC.Cc1nnc(C(C)C)c2cnncc12.
What is the InChIKey of ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine?
The InChIKey is NURMZZXECZPTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4.C2H6/c1-6(2)10-9-5-12-11-4-8(9)7(3)13-14-10;1-2/h4-6H,1-3H3;1-2H3.
What are the key properties of ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine?
ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine has a molecular weight of 218.30 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-propan-2-ylpyridazino[4,5-d]pyridazine is sourced from PubChem (CID 144749665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).