About ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine
ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine (PubChem CID 144749699) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine |
| PubChem CID | 144749699 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine |
| SMILES | CC.Cc1nnc(C(C)C)c2c[nH]cc12 |
| InChI | InChI=1S/C10H13N3.C2H6/c1-6(2)10-9-5-11-4-8(9)7(3)12-13-10;1-2/h4-6,11H,1-3H3;1-2H3 |
| InChIKey | OSPNOZLXAXCIEQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine?
The IUPAC name of ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine (CID 144749699) is ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine.
What is the SMILES notation for ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine?
The canonical SMILES for ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine is CC.Cc1nnc(C(C)C)c2c[nH]cc12.
What is the InChIKey of ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine?
The InChIKey is OSPNOZLXAXCIEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C2H6/c1-6(2)10-9-5-11-4-8(9)7(3)12-13-10;1-2/h4-6,11H,1-3H3;1-2H3.
What are the key properties of ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine?
ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine has a molecular weight of 205.30 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-propan-2-yl-6H-pyrrolo[3,4-d]pyridazine is sourced from PubChem (CID 144749699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).