About 2-methylheptanoic acid
2-methylheptanoic acid (PubChem CID 14475) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-methylheptanoic acid.
Molecular Properties
| Compound Name | 2-methylheptanoic acid |
| PubChem CID | 14475 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-methylheptanoic acid |
| SMILES | CCCCCC(C)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-4-5-6-7(2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | NKBWMBRPILTCRD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptanoic acid?
The IUPAC name of 2-methylheptanoic acid (CID 14475) is 2-methylheptanoic acid.
What is the SMILES notation for 2-methylheptanoic acid?
The canonical SMILES for 2-methylheptanoic acid is CCCCCC(C)C(=O)O.
What is the InChIKey of 2-methylheptanoic acid?
The InChIKey is NKBWMBRPILTCRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-4-5-6-7(2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-methylheptanoic acid?
2-methylheptanoic acid has a molecular weight of 144.21 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptanoic acid is sourced from PubChem (CID 14475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).