About [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane
[2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane (PubChem CID 144750107) has the molecular formula C10H12FO2P
and a molecular weight of 214.18 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane.
Molecular Properties
| Compound Name | [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane |
| PubChem CID | 144750107 |
| Molecular Formula | C10H12FO2P |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane |
| SMILES | Fc1cccc(C2OCC(P)CO2)c1 |
| InChI | InChI=1S/C10H12FO2P/c11-8-3-1-2-7(4-8)10-12-5-9(14)6-13-10/h1-4,9-10H,5-6,14H2 |
| InChIKey | ONTSZKUEKOJIOK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane?
The IUPAC name of [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane (CID 144750107) is [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane.
What is the SMILES notation for [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane?
The canonical SMILES for [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane is Fc1cccc(C2OCC(P)CO2)c1.
What is the InChIKey of [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane?
The InChIKey is ONTSZKUEKOJIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FO2P/c11-8-3-1-2-7(4-8)10-12-5-9(14)6-13-10/h1-4,9-10H,5-6,14H2.
What are the key properties of [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane?
[2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane has a molecular weight of 214.18 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluorophenyl)-1,3-dioxan-5-yl]phosphane is sourced from PubChem (CID 144750107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).