C12H19FN2 — CID 144750404
1-[(3E,5E)-5-fluoro-4-methylhepta-1,3,5-trien-3-yl]piperazine (PubChem CID 144750404) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-[(3E,5E)-5-fluoro-4-methylhepta-1,3,5-trien-3-yl]piperazine.
| Compound Name | 1-[(3E,5E)-5-fluoro-4-methylhepta-1,3,5-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 144750404 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-[(3E,5E)-5-fluoro-4-methylhepta-1,3,5-trien-3-yl]piperazine |
| SMILES | C=C/C(=C(C)\C(F)=C/C)N1CCNCC1 |
| InChI | InChI=1S/C12H19FN2/c1-4-11(13)10(3)12(5-2)15-8-6-14-7-9-15/h4-5,14H,2,6-9H2,1,3H3/b11-4+,12-10+ |
| InChIKey | NDIZGQXJJREZGK-ADAYYPRKSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|