About 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile
2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile (PubChem CID 144751400) has the molecular formula C11H14N2O2S
and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile |
| PubChem CID | 144751400 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.CCc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C7H9NO2S.C4H5N/c1-3-5-8-4(2)6(11-5)7(9)10;1-4(2)3-5/h3H2,1-2H3,(H,9,10);1H2,2H3 |
| InChIKey | XTYCDALBHJXYJE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile?
The IUPAC name of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile (CID 144751400) is 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile.
What is the SMILES notation for 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile?
The canonical SMILES for 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile is C=C(C)C#N.CCc1nc(C)c(C(=O)O)s1.
What is the InChIKey of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile?
The InChIKey is XTYCDALBHJXYJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.C4H5N/c1-3-5-8-4(2)6(11-5)7(9)10;1-4(2)3-5/h3H2,1-2H3,(H,9,10);1H2,2H3.
What are the key properties of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile?
2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile has a molecular weight of 238.31 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile is sourced from PubChem (CID 144751400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).