C11H14N2O2S — CID 144751400
2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile (PubChem CID 144751400) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile.
| Compound Name | 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile |
|---|---|
| PubChem CID | 144751400 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.CCc1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C7H9NO2S.C4H5N/c1-3-5-8-4(2)6(11-5)7(9)10;1-4(2)3-5/h3H2,1-2H3,(H,9,10);1H2,2H3 |
| InChIKey | XTYCDALBHJXYJE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|