C19H15FN2O3S — CID 144751413
2-[(3Z,5Z)-6-cyano-5-(2-fluoro-5-methoxyphenyl)hepta-1,3,5-trien-2-yl]-1,3-thiazole-5-carboxylic acid (PubChem CID 144751413) has the molecular formula C19H15FN2O3S and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[(3Z,5Z)-6-cyano-5-(2-fluoro-5-methoxyphenyl)hepta-1,3,5-trien-2-yl]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3Z,5Z)-6-cyano-5-(2-fluoro-5-methoxyphenyl)hepta-1,3,5-trien-2-yl]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 144751413 |
| Molecular Formula | C19H15FN2O3S |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[(3Z,5Z)-6-cyano-5-(2-fluoro-5-methoxyphenyl)hepta-1,3,5-trien-2-yl]-1,3-thiazole-5-carboxylic acid |
| SMILES | C=C(/C=C\C(=C(/C)C#N)c1cc(OC)ccc1F)c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C19H15FN2O3S/c1-11(18-22-10-17(26-18)19(23)24)4-6-14(12(2)9-21)15-8-13(25-3)5-7-16(15)20/h4-8,10H,1H2,2-3H3,(H,23,24)/b6-4-,14-12- |
| InChIKey | BIUWVFYKHIVEEV-GCCOKGQRSA-N |
| XLogP | 4.56 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|