C19H34O3 — CID 144751921
4-butyl-7,9a-bis(hydroxymethyl)-3,4-dimethyl-2,3,4a,5,8,9-hexahydro-1H-benzo[7]annulen-9-ol (PubChem CID 144751921) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 4-butyl-7,9a-bis(hydroxymethyl)-3,4-dimethyl-2,3,4a,5,8,9-hexahydro-1H-benzo[7]annulen-9-ol.
| Compound Name | 4-butyl-7,9a-bis(hydroxymethyl)-3,4-dimethyl-2,3,4a,5,8,9-hexahydro-1H-benzo[7]annulen-9-ol |
|---|---|
| PubChem CID | 144751921 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-butyl-7,9a-bis(hydroxymethyl)-3,4-dimethyl-2,3,4a,5,8,9-hexahydro-1H-benzo[7]annulen-9-ol |
| SMILES | CCCCC1(C)C(C)CCC2(CO)C(O)CC(CO)=CCC12 |
| InChI | InChI=1S/C19H34O3/c1-4-5-9-18(3)14(2)8-10-19(13-21)16(18)7-6-15(12-20)11-17(19)22/h6,14,16-17,20-22H,4-5,7-13H2,1-3H3 |
| InChIKey | SSDPNBDJBOBHNI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|