About amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde
amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde (PubChem CID 144752106) has the molecular formula C14H26N2O6
and a molecular weight of 318.37 g/mol. Its IUPAC name is amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde.
Molecular Properties
| Compound Name | amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde |
| PubChem CID | 144752106 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde |
| SMILES | C=O.C=O.CCCC.CN(CCC(=O)ON)C(=O)/C=C\C=O |
| InChI | InChI=1S/C8H12N2O4.C4H10.2CH2O/c1-10(5-4-8(13)14-9)7(12)3-2-6-11;1-3-4-2;2*1-2/h2-3,6H,4-5,9H2,1H3;3-4H2,1-2H3;2*1H2/b3-2-;;; |
| InChIKey | RUVKRUQMQHLKBC-GDNGEXCGSA-N |
| XLogP | 0.44 |
| TPSA | 123.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde?
The IUPAC name of amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde (CID 144752106) is amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde.
What is the SMILES notation for amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde?
The canonical SMILES for amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde is C=O.C=O.CCCC.CN(CCC(=O)ON)C(=O)/C=C\C=O.
What is the InChIKey of amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde?
The InChIKey is RUVKRUQMQHLKBC-GDNGEXCGSA-N. The full InChI is InChI=1S/C8H12N2O4.C4H10.2CH2O/c1-10(5-4-8(13)14-9)7(12)3-2-6-11;1-3-4-2;2*1-2/h2-3,6H,4-5,9H2,1H3;3-4H2,1-2H3;2*1H2/b3-2-;;;.
What are the key properties of amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde?
amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde has a molecular weight of 318.37 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for amino 3-[methyl-[(Z)-4-oxobut-2-enoyl]amino]propanoate;butane;formaldehyde is sourced from PubChem (CID 144752106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).