About 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane
2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane (PubChem CID 144752664) has the molecular formula C25H46N6
and a molecular weight of 430.69 g/mol. Its IUPAC name is 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane.
Molecular Properties
| Compound Name | 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane |
| PubChem CID | 144752664 |
| Molecular Formula | C25H46N6 |
| Molecular Weight | 430.69 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane |
| SMILES | CC.CC.CCC(C)c1cncc(N2CCCC2)n1.CCN(CC)c1cncc(C)n1 |
| InChI | InChI=1S/C12H19N3.C9H15N3.2C2H6/c1-3-10(2)11-8-13-9-12(14-11)15-6-4-5-7-15;1-4-12(5-2)9-7-10-6-8(3)11-9;2*1-2/h8-10H,3-7H2,1-2H3;6-7H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | YOKAJDNFCALOKF-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane?
The IUPAC name of 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane (CID 144752664) is 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane.
What is the SMILES notation for 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane?
The canonical SMILES for 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane is CC.CC.CCC(C)c1cncc(N2CCCC2)n1.CCN(CC)c1cncc(C)n1.
What is the InChIKey of 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane?
The InChIKey is YOKAJDNFCALOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3.C9H15N3.2C2H6/c1-3-10(2)11-8-13-9-12(14-11)15-6-4-5-7-15;1-4-12(5-2)9-7-10-6-8(3)11-9;2*1-2/h8-10H,3-7H2,1-2H3;6-7H,4-5H2,1-3H3;2*1-2H3.
What are the key properties of 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane?
2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane has a molecular weight of 430.69 g/mol, XLogP of 6.27, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-6-pyrrolidin-1-ylpyrazine;N,N-diethyl-6-methylpyrazin-2-amine;ethane is sourced from PubChem (CID 144752664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).