About CID 144752924
CID 144752924 (PubChem CID 144752924) has the molecular formula C16H11FN
and a molecular weight of 236.27 g/mol.
Molecular Properties
| Compound Name | CID 144752924 |
| PubChem CID | 144752924 |
| Molecular Formula | C16H11FN |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | — |
| SMILES | Cn1c2ccccc2c2c([C]3C=C3)ccc(F)c21 |
| InChI | InChI=1S/C16H11FN/c1-18-14-5-3-2-4-12(14)15-11(10-6-7-10)8-9-13(17)16(15)18/h2-9H,1H3 |
| InChIKey | AJVDSCMVWUWPJF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 144752924 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144752924?
The IUPAC name of CID 144752924 (CID 144752924) is not available.
What is the SMILES notation for CID 144752924?
The canonical SMILES for CID 144752924 is Cn1c2ccccc2c2c([C]3C=C3)ccc(F)c21.
What is the InChIKey of CID 144752924?
The InChIKey is AJVDSCMVWUWPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN/c1-18-14-5-3-2-4-12(14)15-11(10-6-7-10)8-9-13(17)16(15)18/h2-9H,1H3.
What are the key properties of CID 144752924?
CID 144752924 has a molecular weight of 236.27 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144752924 is sourced from PubChem (CID 144752924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).