C6H7F2N — CID 144753283
N-[(2Z)-1,1-difluoropenta-2,4-dien-2-yl]methanimine (PubChem CID 144753283) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is N-[(2Z)-1,1-difluoropenta-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2Z)-1,1-difluoropenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 144753283 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | N-[(2Z)-1,1-difluoropenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C=C(\N=C)C(F)F |
| InChI | InChI=1S/C6H7F2N/c1-3-4-5(9-2)6(7)8/h3-4,6H,1-2H2/b5-4- |
| InChIKey | HIOOAOPWYHFYAC-PLNGDYQASA-N |
| XLogP | 2.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|