About (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene
(3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene (PubChem CID 144754297) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene.
Molecular Properties
| Compound Name | (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene |
| PubChem CID | 144754297 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene |
| SMILES | C/C=C\C1=C(CC)/C(=C/CC)c2c(CC)cccc21 |
| InChI | InChI=1S/C19H24/c1-5-10-16-15(8-4)17(11-6-2)19-14(7-3)12-9-13-18(16)19/h5,9-13H,6-8H2,1-4H3/b10-5-,17-11- |
| InChIKey | CXVKYPCINCBLQE-PFNQNJAASA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene?
The IUPAC name of (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene (CID 144754297) is (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene.
What is the SMILES notation for (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene?
The canonical SMILES for (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene is C/C=C\C1=C(CC)/C(=C/CC)c2c(CC)cccc21.
What is the InChIKey of (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene?
The InChIKey is CXVKYPCINCBLQE-PFNQNJAASA-N. The full InChI is InChI=1S/C19H24/c1-5-10-16-15(8-4)17(11-6-2)19-14(7-3)12-9-13-18(16)19/h5,9-13H,6-8H2,1-4H3/b10-5-,17-11-.
What are the key properties of (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene?
(3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene has a molecular weight of 252.40 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2,4-diethyl-1-[(Z)-prop-1-enyl]-3-propylideneindene is sourced from PubChem (CID 144754297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).