C22H26FNO2 — CID 144754828
methyl (Z)-2-[ethenyl-[(2Z,4Z)-2-ethenyl-3-(4-fluorophenyl)hexa-2,4-dienyl]amino]pent-2-enoate (PubChem CID 144754828) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is methyl (Z)-2-[ethenyl-[(2Z,4Z)-2-ethenyl-3-(4-fluorophenyl)hexa-2,4-dienyl]amino]pent-2-enoate.
| Compound Name | methyl (Z)-2-[ethenyl-[(2Z,4Z)-2-ethenyl-3-(4-fluorophenyl)hexa-2,4-dienyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 144754828 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | methyl (Z)-2-[ethenyl-[(2Z,4Z)-2-ethenyl-3-(4-fluorophenyl)hexa-2,4-dienyl]amino]pent-2-enoate |
| SMILES | C=C/C(CN(C=C)/C(=C\CC)C(=O)OC)=C(\C=C/C)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FNO2/c1-6-10-20(18-12-14-19(23)15-13-18)17(8-3)16-24(9-4)21(11-7-2)22(25)26-5/h6,8-15H,3-4,7,16H2,1-2,5H3/b10-6-,20-17-,21-11- |
| InChIKey | ZBPIFVPTBGYBET-WSUMNSDISA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|