C23H42N3O8PS2 — CID 144754978
propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methylsulfanylbutoxy]phosphoryl]amino]propanoate (PubChem CID 144754978) has the molecular formula C23H42N3O8PS2 and a molecular weight of 583.71 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methylsulfanylbutoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methylsulfanylbutoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144754978 |
| Molecular Formula | C23H42N3O8PS2 |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | propan-2-yl 2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[4-[[(Z)-3-formamido-3-oxoprop-1-enyl]-methylamino]-2-methylsulfanylbutoxy]phosphoryl]amino]propanoate |
| SMILES | CSC(CCN(C)/C=C\C(=O)NC=O)COP(=O)(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H42N3O8PS2/c1-17(2)34-21(29)18(3)25-35(31,32-13-14-37-22(30)23(4,5)6)33-15-19(36-8)9-11-26(7)12-10-20(28)24-16-27/h10,12,16-19H,9,11,13-15H2,1-8H3,(H,25,31)(H,24,27,28)/b12-10- |
| InChIKey | ZDMNNNIPBINFGH-BENRWUELSA-N |
| XLogP | 3.20 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|