C24H31NO3S — CID 144755445
S-methyl (4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanethioate (PubChem CID 144755445) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is S-methyl (4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanethioate.
| Compound Name | S-methyl (4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanethioate |
|---|---|
| PubChem CID | 144755445 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | S-methyl (4S)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pentanethioate |
| SMILES | CSC(=O)C(C)C[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO3S/c1-17(22(26)29-5)15-21(25-23(27)28-24(2,3)4)16-18-11-13-20(14-12-18)19-9-7-6-8-10-19/h6-14,17,21H,15-16H2,1-5H3,(H,25,27)/t17?,21-/m0/s1 |
| InChIKey | KANSVSHILHMQGQ-LFABVHOISA-N |
| XLogP | 5.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|