About [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol
[1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol (PubChem CID 144755598) has the molecular formula C20H27N3O3
and a molecular weight of 357.45 g/mol. Its IUPAC name is [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol.
Molecular Properties
| Compound Name | [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol |
| PubChem CID | 144755598 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol |
| SMILES | O=[N+]([O-])C1(CO)CN(CC2=CCCC=C2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O3/c24-17-20(23(25)26)15-21(13-18-7-3-1-4-8-18)11-12-22(16-20)14-19-9-5-2-6-10-19/h1,3-5,7-10,24H,2,6,11-17H2 |
| InChIKey | SFCKKWLRRBRTKI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol?
The IUPAC name of [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol (CID 144755598) is [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol.
What is the SMILES notation for [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol?
The canonical SMILES for [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol is O=[N+]([O-])C1(CO)CN(CC2=CCCC=C2)CCN(Cc2ccccc2)C1.
What is the InChIKey of [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol?
The InChIKey is SFCKKWLRRBRTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O3/c24-17-20(23(25)26)15-21(13-18-7-3-1-4-8-18)11-12-22(16-20)14-19-9-5-2-6-10-19/h1,3-5,7-10,24H,2,6,11-17H2.
What are the key properties of [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol?
[1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol has a molecular weight of 357.45 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-benzyl-4-(cyclohexa-1,5-dien-1-ylmethyl)-6-nitro-1,4-diazepan-6-yl]methanol is sourced from PubChem (CID 144755598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).