About 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine
3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine (PubChem CID 144756159) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine.
Molecular Properties
| Compound Name | 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine |
| PubChem CID | 144756159 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine |
| SMILES | C=C(C)/C=C\C(=C)OC1CCNC1 |
| InChI | InChI=1S/C11H17NO/c1-9(2)4-5-10(3)13-11-6-7-12-8-11/h4-5,11-12H,1,3,6-8H2,2H3/b5-4- |
| InChIKey | FDESOECPEZXUSM-PLNGDYQASA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine?
The IUPAC name of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine (CID 144756159) is 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine.
What is the SMILES notation for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine?
The canonical SMILES for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine is C=C(C)/C=C\C(=C)OC1CCNC1.
What is the InChIKey of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine?
The InChIKey is FDESOECPEZXUSM-PLNGDYQASA-N. The full InChI is InChI=1S/C11H17NO/c1-9(2)4-5-10(3)13-11-6-7-12-8-11/h4-5,11-12H,1,3,6-8H2,2H3/b5-4-.
What are the key properties of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine?
3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine has a molecular weight of 179.26 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxypyrrolidine is sourced from PubChem (CID 144756159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).