C19H15Cl3N4O — CID 144756209
(Z)-2-[amino-[4-(2,5-dichlorophenoxy)-3-pyridinyl]amino]-2-(2-chlorophenyl)ethenamine (PubChem CID 144756209) has the molecular formula C19H15Cl3N4O and a molecular weight of 421.72 g/mol. Its IUPAC name is (Z)-2-[amino-[4-(2,5-dichlorophenoxy)-3-pyridinyl]amino]-2-(2-chlorophenyl)ethenamine.
| Compound Name | (Z)-2-[amino-[4-(2,5-dichlorophenoxy)-3-pyridinyl]amino]-2-(2-chlorophenyl)ethenamine |
|---|---|
| PubChem CID | 144756209 |
| Molecular Formula | C19H15Cl3N4O |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (Z)-2-[amino-[4-(2,5-dichlorophenoxy)-3-pyridinyl]amino]-2-(2-chlorophenyl)ethenamine |
| SMILES | N/C=C(/c1ccccc1Cl)N(N)c1cnccc1Oc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H15Cl3N4O/c20-12-5-6-15(22)19(9-12)27-18-7-8-25-11-17(18)26(24)16(10-23)13-3-1-2-4-14(13)21/h1-11H,23-24H2/b16-10- |
| InChIKey | IAQRHBXYKRMDCI-YBEGLDIGSA-N |
| XLogP | 5.47 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|