C19H25N3O — CID 144756966
formamide;1-[(3-pyridin-3-ylphenyl)methyl]cyclohexan-1-amine (PubChem CID 144756966) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is formamide;1-[(3-pyridin-3-ylphenyl)methyl]cyclohexan-1-amine.
| Compound Name | formamide;1-[(3-pyridin-3-ylphenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 144756966 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | formamide;1-[(3-pyridin-3-ylphenyl)methyl]cyclohexan-1-amine |
| SMILES | NC1(Cc2cccc(-c3cccnc3)c2)CCCCC1.NC=O |
| InChI | InChI=1S/C18H22N2.CH3NO/c19-18(9-2-1-3-10-18)13-15-6-4-7-16(12-15)17-8-5-11-20-14-17;2-1-3/h4-8,11-12,14H,1-3,9-10,13,19H2;1H,(H2,2,3) |
| InChIKey | QMAPYAVJBWBDOD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|