C27H33ClF3N3O2 — CID 144757114
2-chloro-N-(cyclohexylmethyl)-5-[2-(1-hydroxycyclohexyl)ethynyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide (PubChem CID 144757114) has the molecular formula C27H33ClF3N3O2 and a molecular weight of 524.03 g/mol. Its IUPAC name is 2-chloro-N-(cyclohexylmethyl)-5-[2-(1-hydroxycyclohexyl)ethynyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide.
| Compound Name | 2-chloro-N-(cyclohexylmethyl)-5-[2-(1-hydroxycyclohexyl)ethynyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 144757114 |
| Molecular Formula | C27H33ClF3N3O2 |
| Molecular Weight | 524.03 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 2-chloro-N-(cyclohexylmethyl)-5-[2-(1-hydroxycyclohexyl)ethynyl]-3-[[4-(trifluoromethyl)phenyl]methyl]-1,2-dihydroimidazole-4-carboxamide |
| SMILES | O=C(NCC1CCCCC1)C1=C(C#CC2(O)CCCCC2)NC(Cl)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H33ClF3N3O2/c28-25-33-22(13-16-26(36)14-5-2-6-15-26)23(24(35)32-17-19-7-3-1-4-8-19)34(25)18-20-9-11-21(12-10-20)27(29,30)31/h9-12,19,25,33,36H,1-8,14-15,17-18H2,(H,32,35) |
| InChIKey | KLBBIYYZWYUBPQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|