About ethane;2,3,6-trifluoro-5-methylbenzenethiol
ethane;2,3,6-trifluoro-5-methylbenzenethiol (PubChem CID 144757711) has the molecular formula C9H11F3S
and a molecular weight of 208.25 g/mol. Its IUPAC name is ethane;2,3,6-trifluoro-5-methylbenzenethiol.
Molecular Properties
| Compound Name | ethane;2,3,6-trifluoro-5-methylbenzenethiol |
| PubChem CID | 144757711 |
| Molecular Formula | C9H11F3S |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | ethane;2,3,6-trifluoro-5-methylbenzenethiol |
| SMILES | CC.Cc1cc(F)c(F)c(S)c1F |
| InChI | InChI=1S/C7H5F3S.C2H6/c1-3-2-4(8)6(10)7(11)5(3)9;1-2/h2,11H,1H3;1-2H3 |
| InChIKey | VNEAPIZKNHYDDO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;2,3,6-trifluoro-5-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,3,6-trifluoro-5-methylbenzenethiol?
The IUPAC name of ethane;2,3,6-trifluoro-5-methylbenzenethiol (CID 144757711) is ethane;2,3,6-trifluoro-5-methylbenzenethiol.
What is the SMILES notation for ethane;2,3,6-trifluoro-5-methylbenzenethiol?
The canonical SMILES for ethane;2,3,6-trifluoro-5-methylbenzenethiol is CC.Cc1cc(F)c(F)c(S)c1F.
What is the InChIKey of ethane;2,3,6-trifluoro-5-methylbenzenethiol?
The InChIKey is VNEAPIZKNHYDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3S.C2H6/c1-3-2-4(8)6(10)7(11)5(3)9;1-2/h2,11H,1H3;1-2H3.
What are the key properties of ethane;2,3,6-trifluoro-5-methylbenzenethiol?
ethane;2,3,6-trifluoro-5-methylbenzenethiol has a molecular weight of 208.25 g/mol, XLogP of 3.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,3,6-trifluoro-5-methylbenzenethiol is sourced from PubChem (CID 144757711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).