C14H20O2 — CID 144757857
3-butan-2-yl-6-methoxy-3,4-dihydro-2H-chromene (PubChem CID 144757857) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-butan-2-yl-6-methoxy-3,4-dihydro-2H-chromene.
| Compound Name | 3-butan-2-yl-6-methoxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 144757857 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-butan-2-yl-6-methoxy-3,4-dihydro-2H-chromene |
| SMILES | CCC(C)C1COc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C14H20O2/c1-4-10(2)12-7-11-8-13(15-3)5-6-14(11)16-9-12/h5-6,8,10,12H,4,7,9H2,1-3H3 |
| InChIKey | ZFJCQMUAVSVWET-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |