C14H20F2N2O2S — CID 144758213
tert-butyl N-[[5-amino-2-(difluoromethylsulfanyl)phenyl]methyl]-N-methylcarbamate (PubChem CID 144758213) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is tert-butyl N-[[5-amino-2-(difluoromethylsulfanyl)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[5-amino-2-(difluoromethylsulfanyl)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 144758213 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | tert-butyl N-[[5-amino-2-(difluoromethylsulfanyl)phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cc(N)ccc1SC(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20F2N2O2S/c1-14(2,3)20-13(19)18(4)8-9-7-10(17)5-6-11(9)21-12(15)16/h5-7,12H,8,17H2,1-4H3 |
| InChIKey | SNJNTKBZQATMRH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|