C33H41NO3S — CID 144759042
ethane;ethyl (E)-3-[5-benzylsulfanyl-2-[4,5-bis(ethenyl)-2-methoxyanilino]phenyl]prop-2-enoate (PubChem CID 144759042) has the molecular formula C33H41NO3S and a molecular weight of 531.76 g/mol. Its IUPAC name is ethane;ethyl (E)-3-[5-benzylsulfanyl-2-[4,5-bis(ethenyl)-2-methoxyanilino]phenyl]prop-2-enoate.
| Compound Name | ethane;ethyl (E)-3-[5-benzylsulfanyl-2-[4,5-bis(ethenyl)-2-methoxyanilino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 144759042 |
| Molecular Formula | C33H41NO3S |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | ethane;ethyl (E)-3-[5-benzylsulfanyl-2-[4,5-bis(ethenyl)-2-methoxyanilino]phenyl]prop-2-enoate |
| SMILES | C=Cc1cc(Nc2ccc(SCc3ccccc3)cc2/C=C/C(=O)OCC)c(OC)cc1C=C.CC.CC |
| InChI | InChI=1S/C29H29NO3S.2C2H6/c1-5-22-18-27(28(32-4)19-23(22)6-2)30-26-15-14-25(34-20-21-11-9-8-10-12-21)17-24(26)13-16-29(31)33-7-3;2*1-2/h5-6,8-19,30H,1-2,7,20H2,3-4H3;2*1-2H3/b16-13+;; |
| InChIKey | FZZYPVLOODCGGS-YNHPUKFJSA-N |
| XLogP | 9.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|