C22H26F2N2O2 — CID 144760281
N-cyclopentyl-4-(2,4-difluorophenyl)-N-methylbenzamide;propanamide (PubChem CID 144760281) has the molecular formula C22H26F2N2O2 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4-difluorophenyl)-N-methylbenzamide;propanamide.
| Compound Name | N-cyclopentyl-4-(2,4-difluorophenyl)-N-methylbenzamide;propanamide |
|---|---|
| PubChem CID | 144760281 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-cyclopentyl-4-(2,4-difluorophenyl)-N-methylbenzamide;propanamide |
| SMILES | CCC(N)=O.CN(C(=O)c1ccc(-c2ccc(F)cc2F)cc1)C1CCCC1 |
| InChI | InChI=1S/C19H19F2NO.C3H7NO/c1-22(16-4-2-3-5-16)19(23)14-8-6-13(7-9-14)17-11-10-15(20)12-18(17)21;1-2-3(4)5/h6-12,16H,2-5H2,1H3;2H2,1H3,(H2,4,5) |
| InChIKey | SOXBABKXYZECNA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |