About 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol
4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol (PubChem CID 144760738) has the molecular formula C16H14ClNO
and a molecular weight of 271.75 g/mol. Its IUPAC name is 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol.
Molecular Properties
| Compound Name | 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol |
| PubChem CID | 144760738 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol |
| SMILES | Oc1ccc(-c2cc3c(cc2Cl)NC2(CC2)C3)cc1 |
| InChI | InChI=1S/C16H14ClNO/c17-14-8-15-11(9-16(18-15)5-6-16)7-13(14)10-1-3-12(19)4-2-10/h1-4,7-8,18-19H,5-6,9H2 |
| InChIKey | MWODAYXNNUOFKB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol?
The IUPAC name of 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol (CID 144760738) is 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol.
What is the SMILES notation for 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol?
The canonical SMILES for 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol is Oc1ccc(-c2cc3c(cc2Cl)NC2(CC2)C3)cc1.
What is the InChIKey of 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol?
The InChIKey is MWODAYXNNUOFKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO/c17-14-8-15-11(9-16(18-15)5-6-16)7-13(14)10-1-3-12(19)4-2-10/h1-4,7-8,18-19H,5-6,9H2.
What are the key properties of 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol?
4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol has a molecular weight of 271.75 g/mol, XLogP of 4.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chlorospiro[1,3-dihydroindole-2,1'-cyclopropane]-5-yl)phenol is sourced from PubChem (CID 144760738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).