About 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine
2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine (PubChem CID 144761130) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 144761130 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine |
| SMILES | COCCOC1=C(N)CCC(C)=C1 |
| InChI | InChI=1S/C10H17NO2/c1-8-3-4-9(11)10(7-8)13-6-5-12-2/h7H,3-6,11H2,1-2H3 |
| InChIKey | JEUGXGWBBLPDEX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine (CID 144761130) is 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine is COCCOC1=C(N)CCC(C)=C1.
What is the InChIKey of 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is JEUGXGWBBLPDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8-3-4-9(11)10(7-8)13-6-5-12-2/h7H,3-6,11H2,1-2H3.
What are the key properties of 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine?
2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 183.25 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)-4-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 144761130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).