About 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine
2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine (PubChem CID 144761137) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 144761137 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine |
| SMILES | COCCCOC1=C(N)CCC(C)=C1 |
| InChI | InChI=1S/C11H19NO2/c1-9-4-5-10(12)11(8-9)14-7-3-6-13-2/h8H,3-7,12H2,1-2H3 |
| InChIKey | KYYDTGWNSQTEIZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine (CID 144761137) is 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine is COCCCOC1=C(N)CCC(C)=C1.
What is the InChIKey of 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is KYYDTGWNSQTEIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-9-4-5-10(12)11(8-9)14-7-3-6-13-2/h8H,3-7,12H2,1-2H3.
What are the key properties of 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine?
2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 197.28 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropoxy)-4-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 144761137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).