C25H34N3P — CID 144761377
N-[2,6-di(propan-2-yl)phenyl]-N-methanimidoyl-2-[(3R)-1,2,3-trimethylphosphiran-2-yl]benzenecarboximidamide (PubChem CID 144761377) has the molecular formula C25H34N3P and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-N-methanimidoyl-2-[(3R)-1,2,3-trimethylphosphiran-2-yl]benzenecarboximidamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-N-methanimidoyl-2-[(3R)-1,2,3-trimethylphosphiran-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144761377 |
| Molecular Formula | C25H34N3P |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-N-methanimidoyl-2-[(3R)-1,2,3-trimethylphosphiran-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C/N(/C(=N/[H])c1ccccc1C1(C)[C@@H](C)P1C)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C25H34N3P/c1-16(2)19-12-10-13-20(17(3)4)23(19)28(15-26)24(27)21-11-8-9-14-22(21)25(6)18(5)29(25)7/h8-18,26-27H,1-7H3/b26-15+,27-24+/t18-,25?,29?/m1/s1 |
| InChIKey | YDXRZIHWQFOXGM-HDJYNAAJSA-N |
| XLogP | 7.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|