C15H14N2O6S — CID 144762956
3-[5-(3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 144762956) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-[5-(3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[5-(3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 144762956 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3-[5-(3-hydroxy-5-methyl-2-oxo-1H-indol-3-yl)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1ccc2c(c1)C(O)(C1SC(=O)N(CCC(=O)O)C1=O)C(=O)N2 |
| InChI | InChI=1S/C15H14N2O6S/c1-7-2-3-9-8(6-7)15(23,13(21)16-9)11-12(20)17(14(22)24-11)5-4-10(18)19/h2-3,6,11,23H,4-5H2,1H3,(H,16,21)(H,18,19) |
| InChIKey | FCSVFYRTBSEHNA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|