About ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide
ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144763012) has the molecular formula C19H35NO3
and a molecular weight of 325.49 g/mol. Its IUPAC name is ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 144763012 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=CC.CC.CCCOCCOCCNC(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C14H23NO3.C3H6.C2H6/c1-2-9-17-11-12-18-10-8-15-14(16)13-6-4-3-5-7-13;1-3-2;1-2/h4,6-7H,2-3,5,8-12H2,1H3,(H,15,16);3H,1H2,2H3;1-2H3 |
| InChIKey | LXCMLEDXICBAPM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide (CID 144763012) is ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide is C=CC.CC.CCCOCCOCCNC(=O)C1=CCCC=C1.
What is the InChIKey of ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide?
The InChIKey is LXCMLEDXICBAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3.C3H6.C2H6/c1-2-9-17-11-12-18-10-8-15-14(16)13-6-4-3-5-7-13;1-3-2;1-2/h4,6-7H,2-3,5,8-12H2,1H3,(H,15,16);3H,1H2,2H3;1-2H3.
What are the key properties of ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide?
ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide has a molecular weight of 325.49 g/mol, XLogP of 4.04, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;prop-1-ene;N-[2-(2-propoxyethoxy)ethyl]cyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 144763012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).