C14H25NO2 — CID 144763082
ethane;(2E)-2-ethenyl-N-(2-propoxyethyl)penta-2,4-dienamide (PubChem CID 144763082) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N-(2-propoxyethyl)penta-2,4-dienamide.
| Compound Name | ethane;(2E)-2-ethenyl-N-(2-propoxyethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144763082 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N-(2-propoxyethyl)penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)NCCOCCC.CC |
| InChI | InChI=1S/C12H19NO2.C2H6/c1-4-7-11(6-3)12(14)13-8-10-15-9-5-2;1-2/h4,6-7H,1,3,5,8-10H2,2H3,(H,13,14);1-2H3/b11-7+; |
| InChIKey | GJDSQLGFHNNERX-RVDQCCQOSA-N |
| XLogP | 2.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|