About 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione
6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 144763367) has the molecular formula C17H13F2N3O2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 144763367 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NCc2ccccc2)[nH]c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-12-6-13(19)8-14(7-12)22-16(23)9-15(21-17(22)24)20-10-11-4-2-1-3-5-11/h1-9,20H,10H2,(H,21,24) |
| InChIKey | NOZLYGIAYHUVDH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione (CID 144763367) is 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione is O=c1cc(NCc2ccccc2)[nH]c(=O)n1-c1cc(F)cc(F)c1.
What is the InChIKey of 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione?
The InChIKey is NOZLYGIAYHUVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O2/c18-12-6-13(19)8-14(7-12)22-16(23)9-15(21-17(22)24)20-10-11-4-2-1-3-5-11/h1-9,20H,10H2,(H,21,24).
What are the key properties of 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione?
6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione has a molecular weight of 329.31 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzylamino)-3-(3,5-difluorophenyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 144763367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).