About [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate
[3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate (PubChem CID 14476382) has the molecular formula C24H26N2O3
and a molecular weight of 390.48 g/mol. Its IUPAC name is [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate.
Molecular Properties
| Compound Name | [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate |
| PubChem CID | 14476382 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate |
| SMILES | CC(=O)OC1c2ccccc2C(=O)N1CCCN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O3/c1-18(27)29-24-22-11-6-5-10-21(22)23(28)26(24)15-7-14-25-16-12-20(13-17-25)19-8-3-2-4-9-19/h2-6,8-12,24H,7,13-17H2,1H3 |
| InChIKey | PTNAKZVEBKYXNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate?
The IUPAC name of [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate (CID 14476382) is [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate.
What is the SMILES notation for [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate?
The canonical SMILES for [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate is CC(=O)OC1c2ccccc2C(=O)N1CCCN1CC=C(c2ccccc2)CC1.
What is the InChIKey of [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate?
The InChIKey is PTNAKZVEBKYXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O3/c1-18(27)29-24-22-11-6-5-10-21(22)23(28)26(24)15-7-14-25-16-12-20(13-17-25)19-8-3-2-4-9-19/h2-6,8-12,24H,7,13-17H2,1H3.
What are the key properties of [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate?
[3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate has a molecular weight of 390.48 g/mol, XLogP of 3.88, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-2-[3-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1H-isoindol-1-yl] acetate is sourced from PubChem (CID 14476382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).