About CID 144763925
CID 144763925 (PubChem CID 144763925) has the molecular formula C33H28FN4O5S+
and a molecular weight of 611.68 g/mol.
Molecular Properties
| Compound Name | CID 144763925 |
| PubChem CID | 144763925 |
| Molecular Formula | C33H28FN4O5S+ |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)[S+](C)(=O)O)c(-c3ccc4ncn(Cc5ccccc5)c(=O)c4c3)cc12 |
| InChI | InChI=1S/C33H27FN4O5S/c1-35-32(39)30-26-16-24(22-11-14-27-25(15-22)33(40)38(19-36-27)18-20-7-5-4-6-8-20)28(37(2)44(3,41)42)17-29(26)43-31(30)21-9-12-23(34)13-10-21/h4-17,19H,18H2,1-3H3,(H-,35,39,41,42)/p+1 |
| InChIKey | UJELUPXHYDACNG-UHFFFAOYSA-O |
| XLogP | 5.98 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 144763925 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144763925?
The IUPAC name of CID 144763925 (CID 144763925) is not available.
What is the SMILES notation for CID 144763925?
The canonical SMILES for CID 144763925 is CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)[S+](C)(=O)O)c(-c3ccc4ncn(Cc5ccccc5)c(=O)c4c3)cc12.
What is the InChIKey of CID 144763925?
The InChIKey is UJELUPXHYDACNG-UHFFFAOYSA-O. The full InChI is InChI=1S/C33H27FN4O5S/c1-35-32(39)30-26-16-24(22-11-14-27-25(15-22)33(40)38(19-36-27)18-20-7-5-4-6-8-20)28(37(2)44(3,41)42)17-29(26)43-31(30)21-9-12-23(34)13-10-21/h4-17,19H,18H2,1-3H3,(H-,35,39,41,42)/p+1.
What are the key properties of CID 144763925?
CID 144763925 has a molecular weight of 611.68 g/mol, XLogP of 5.98, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144763925 is sourced from PubChem (CID 144763925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).