C33H28FN4O5S+ — CID 144763925
CID 144763925 (PubChem CID 144763925) has the molecular formula C33H28FN4O5S+ and a molecular weight of 611.68 g/mol.
| Compound Name | CID 144763925 |
|---|---|
| PubChem CID | 144763925 |
| Molecular Formula | C33H28FN4O5S+ |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)[S+](C)(=O)O)c(-c3ccc4ncn(Cc5ccccc5)c(=O)c4c3)cc12 |
| InChI | InChI=1S/C33H27FN4O5S/c1-35-32(39)30-26-16-24(22-11-14-27-25(15-22)33(40)38(19-36-27)18-20-7-5-4-6-8-20)28(37(2)44(3,41)42)17-29(26)43-31(30)21-9-12-23(34)13-10-21/h4-17,19H,18H2,1-3H3,(H-,35,39,41,42)/p+1 |
| InChIKey | UJELUPXHYDACNG-UHFFFAOYSA-O |
| XLogP | 5.98 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|