C32H24F2N4O3S — CID 144764067
5-(15-fluoro-6-oxo-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaen-4-yl)-2-(4-fluorophenyl)-N-methyl-6-[methyl(sulfanyl)amino]-1-benzofuran-3-carboxamide (PubChem CID 144764067) has the molecular formula C32H24F2N4O3S and a molecular weight of 582.63 g/mol. Its IUPAC name is 5-(15-fluoro-6-oxo-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaen-4-yl)-2-(4-fluorophenyl)-N-methyl-6-[methyl(sulfanyl)amino]-1-benzofuran-3-carboxamide.
| Compound Name | 5-(15-fluoro-6-oxo-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaen-4-yl)-2-(4-fluorophenyl)-N-methyl-6-[methyl(sulfanyl)amino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144764067 |
| Molecular Formula | C32H24F2N4O3S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | 5-(15-fluoro-6-oxo-7,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,11(16),12,14-hexaen-4-yl)-2-(4-fluorophenyl)-N-methyl-6-[methyl(sulfanyl)amino]-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S)c(-c3cc4n(c(=O)c3)CCn3c-4cc4c(F)cccc43)cc12 |
| InChI | InChI=1S/C32H24F2N4O3S/c1-35-32(40)30-22-14-20(25(36(2)42)16-28(22)41-31(30)17-6-8-19(33)9-7-17)18-12-26-27-15-21-23(34)4-3-5-24(21)37(27)10-11-38(26)29(39)13-18/h3-9,12-16,42H,10-11H2,1-2H3,(H,35,40) |
| InChIKey | BCLIKLTYYKXIKQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|