C26H26F2N2O3 — CID 144765196
3,5-difluoro-N-methylpyridin-4-amine;4-(6-ethyl-2,2-dimethyl-4-oxo-3H-chromen-7-yl)benzaldehyde (PubChem CID 144765196) has the molecular formula C26H26F2N2O3 and a molecular weight of 452.50 g/mol. Its IUPAC name is 3,5-difluoro-N-methylpyridin-4-amine;4-(6-ethyl-2,2-dimethyl-4-oxo-3H-chromen-7-yl)benzaldehyde.
| Compound Name | 3,5-difluoro-N-methylpyridin-4-amine;4-(6-ethyl-2,2-dimethyl-4-oxo-3H-chromen-7-yl)benzaldehyde |
|---|---|
| PubChem CID | 144765196 |
| Molecular Formula | C26H26F2N2O3 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3,5-difluoro-N-methylpyridin-4-amine;4-(6-ethyl-2,2-dimethyl-4-oxo-3H-chromen-7-yl)benzaldehyde |
| SMILES | CCc1cc2c(cc1-c1ccc(C=O)cc1)OC(C)(C)CC2=O.CNc1c(F)cncc1F |
| InChI | InChI=1S/C20H20O3.C6H6F2N2/c1-4-14-9-17-18(22)11-20(2,3)23-19(17)10-16(14)15-7-5-13(12-21)6-8-15;1-9-6-4(7)2-10-3-5(6)8/h5-10,12H,4,11H2,1-3H3;2-3H,1H3,(H,9,10) |
| InChIKey | JZDDOBRAKBSUQB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|