C27H59N4P — CID 144765341
N'-[3-(dimethylamino)propyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine;N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine;methylphosphane (PubChem CID 144765341) has the molecular formula C27H59N4P and a molecular weight of 470.77 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine;N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine;methylphosphane.
| Compound Name | N'-[3-(dimethylamino)propyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine;N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine;methylphosphane |
|---|---|
| PubChem CID | 144765341 |
| Molecular Formula | C27H59N4P |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.45 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine;N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine;methylphosphane |
| SMILES | C=C/C=C(\N=C\C)C(CC)CC(C)(C)C.CCN(CCCN(C)C)CCCN(C)C.CP |
| InChI | InChI=1S/C14H25N.C12H29N3.CH5P/c1-7-10-13(15-9-3)12(8-2)11-14(4,5)6;1-6-15(11-7-9-13(2)3)12-8-10-14(4)5;1-2/h7,9-10,12H,1,8,11H2,2-6H3;6-12H2,1-5H3;2H2,1H3/b13-10-,15-9+;; |
| InChIKey | HICWWSFIUISXAI-QAWVHZCBSA-N |
| XLogP | 6.31 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|