C24H43N4O8P — CID 144766756
[[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-(3,3-dimethyl-2-oxobutanoyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine (PubChem CID 144766756) has the molecular formula C24H43N4O8P and a molecular weight of 546.60 g/mol. Its IUPAC name is [[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-(3,3-dimethyl-2-oxobutanoyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine.
| Compound Name | [[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-(3,3-dimethyl-2-oxobutanoyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine |
|---|---|
| PubChem CID | 144766756 |
| Molecular Formula | C24H43N4O8P |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | [[5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-(3,3-dimethyl-2-oxobutanoyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine |
| SMILES | CC.CC(C)(C)C(=O)OCOP(OCC1CCC(n2ccc(N)nc2=O)O1)C(=O)C(=O)C(C)(C)C.CN |
| InChI | InChI=1S/C21H32N3O8P.C2H6.CH5N/c1-20(2,3)16(25)17(26)33(31-12-29-18(27)21(4,5)6)30-11-13-7-8-15(32-13)24-10-9-14(22)23-19(24)28;2*1-2/h9-10,13,15H,7-8,11-12H2,1-6H3,(H2,22,23,28);1-2H3;2H2,1H3 |
| InChIKey | DDNWVWXAWNLODV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 175.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|