C19H18N2O2 — CID 14476701
1,9-dimethoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole (PubChem CID 14476701) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1,9-dimethoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole.
| Compound Name | 1,9-dimethoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 14476701 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1,9-dimethoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazole |
| SMILES | COc1ccc2[nH]c3c(C)c4ccnc(OC)c4c(C)c3c2c1 |
| InChI | InChI=1S/C19H18N2O2/c1-10-13-7-8-20-19(23-4)17(13)11(2)16-14-9-12(22-3)5-6-15(14)21-18(10)16/h5-9,21H,1-4H3 |
| InChIKey | UBJUKRKZDWCFLP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |