C25H47N4O9P — CID 144767240
[[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxycarbonyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine (PubChem CID 144767240) has the molecular formula C25H47N4O9P and a molecular weight of 578.64 g/mol. Its IUPAC name is [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxycarbonyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine.
| Compound Name | [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxycarbonyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine |
|---|---|
| PubChem CID | 144767240 |
| Molecular Formula | C25H47N4O9P |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | [[5-[[(Z)-3-amino-3-formyliminoprop-1-enyl]-methylamino]oxolan-2-yl]methoxy-(2,2-dimethylpropanoyloxycarbonyl)phosphanyl]oxymethyl 2,2-dimethylpropanoate;ethane;methanamine |
| SMILES | CC.CN.CN(/C=C\C(N)=N\C=O)C1CCC(COP(OCOC(=O)C(C)(C)C)C(=O)OC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H36N3O9P.C2H6.CH5N/c1-21(2,3)18(27)30-14-32-35(20(29)34-19(28)22(4,5)6)31-12-15-8-9-17(33-15)25(7)11-10-16(23)24-13-26;2*1-2/h10-11,13,15,17H,8-9,12,14H2,1-7H3,(H2,23,24,26);1-2H3;2H2,1H3/b11-10-;; |
| InChIKey | IFLOFSDTBDXAIQ-PQBRBDCOSA-N |
| XLogP | 3.65 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|