About N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine
N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine (PubChem CID 144767673) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
| PubChem CID | 144767673 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine |
| SMILES | Cc1ncc(N(C)C2CNC2)c2cc[nH]c12 |
| InChI | InChI=1S/C12H16N4/c1-8-12-10(3-4-14-12)11(7-15-8)16(2)9-5-13-6-9/h3-4,7,9,13-14H,5-6H2,1-2H3 |
| InChIKey | IUNUCSOOHCBDJR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The IUPAC name of N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine (CID 144767673) is N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine.
What is the SMILES notation for N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The canonical SMILES for N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine is Cc1ncc(N(C)C2CNC2)c2cc[nH]c12.
What is the InChIKey of N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
The InChIKey is IUNUCSOOHCBDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-8-12-10(3-4-14-12)11(7-15-8)16(2)9-5-13-6-9/h3-4,7,9,13-14H,5-6H2,1-2H3.
What are the key properties of N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine?
N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine has a molecular weight of 216.29 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-N,7-dimethyl-1H-pyrrolo[2,3-c]pyridin-4-amine is sourced from PubChem (CID 144767673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).