C19H27N3O3S — CID 144767700
4-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-N,N,3-trimethylcyclohexa-1,5-diene-1-sulfonamide (PubChem CID 144767700) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 4-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-N,N,3-trimethylcyclohexa-1,5-diene-1-sulfonamide.
| Compound Name | 4-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-N,N,3-trimethylcyclohexa-1,5-diene-1-sulfonamide |
|---|---|
| PubChem CID | 144767700 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-N,N,3-trimethylcyclohexa-1,5-diene-1-sulfonamide |
| SMILES | Cc1ccc2n1CCN(C(=O)C1C=CC(S(=O)(=O)N(C)C)=CC1C)C2C |
| InChI | InChI=1S/C19H27N3O3S/c1-13-12-16(26(24,25)20(4)5)7-8-17(13)19(23)22-11-10-21-14(2)6-9-18(21)15(22)3/h6-9,12-13,15,17H,10-11H2,1-5H3 |
| InChIKey | JXQSEAGMUUZRCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |