C25H48 — CID 144767743
(1R,4aS,5R,6S)-1,5,6-trimethyl-5-[(E)-3-methylhex-3-enyl]-2,3,4,4a,6,7-hexahydro-1H-naphthalene;ethane;propane (PubChem CID 144767743) has the molecular formula C25H48 and a molecular weight of 348.66 g/mol. Its IUPAC name is (1R,4aS,5R,6S)-1,5,6-trimethyl-5-[(E)-3-methylhex-3-enyl]-2,3,4,4a,6,7-hexahydro-1H-naphthalene;ethane;propane.
| Compound Name | (1R,4aS,5R,6S)-1,5,6-trimethyl-5-[(E)-3-methylhex-3-enyl]-2,3,4,4a,6,7-hexahydro-1H-naphthalene;ethane;propane |
|---|---|
| PubChem CID | 144767743 |
| Molecular Formula | C25H48 |
| Molecular Weight | 348.66 g/mol |
| Exact Mass | 348.38 |
| IUPAC Name | (1R,4aS,5R,6S)-1,5,6-trimethyl-5-[(E)-3-methylhex-3-enyl]-2,3,4,4a,6,7-hexahydro-1H-naphthalene;ethane;propane |
| SMILES | CC.CC/C=C(\C)CC[C@@]1(C)[C@@H]2CCC[C@@H](C)C2=CC[C@@H]1C.CCC |
| InChI | InChI=1S/C20H34.C3H8.C2H6/c1-6-8-15(2)13-14-20(5)17(4)11-12-18-16(3)9-7-10-19(18)20;1-3-2;1-2/h8,12,16-17,19H,6-7,9-11,13-14H2,1-5H3;3H2,1-2H3;1-2H3/b15-8+;;/t16-,17+,19-,20-;;/m1../s1 |
| InChIKey | XDTQIJWTYCCMIV-STHWNZERSA-N |
| XLogP | 8.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.66 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|