About 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one
4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one (PubChem CID 144767971) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one.
Molecular Properties
| Compound Name | 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one |
| PubChem CID | 144767971 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one |
| SMILES | CNc1cc(C)c(C)c(CCC(C)=O)c1 |
| InChI | InChI=1S/C13H19NO/c1-9-7-13(14-4)8-12(11(9)3)6-5-10(2)15/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | RVDHYUSYPPRFCI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one?
The IUPAC name of 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one (CID 144767971) is 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one.
What is the SMILES notation for 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one?
The canonical SMILES for 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one is CNc1cc(C)c(C)c(CCC(C)=O)c1.
What is the InChIKey of 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one?
The InChIKey is RVDHYUSYPPRFCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-9-7-13(14-4)8-12(11(9)3)6-5-10(2)15/h7-8,14H,5-6H2,1-4H3.
What are the key properties of 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one?
4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one has a molecular weight of 205.30 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,3-dimethyl-5-(methylamino)phenyl]butan-2-one is sourced from PubChem (CID 144767971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).